| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:03 UTC |
|---|
| Update Date | 2025-03-21 18:38:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120105 |
|---|
| Frequency | 21.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H30N2O |
|---|
| Molecular Mass | 398.2358 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCc2ccccc2C1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | QGSXHNRQJVVBKL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaralkylaminesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidestertiary carboxylic acid amidestetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupamino acid or derivativescarboxylic acid derivativearalkylamineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundphenylacetamidetertiary amineorganoheterocyclic compoundazacycletertiary aliphatic aminecarboxamide groupn-acyl-amineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
