| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:04 UTC |
|---|
| Update Date | 2025-03-21 18:38:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120145 |
|---|
| Frequency | 37.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9N5O4 |
|---|
| Molecular Mass | 251.0655 |
|---|
| SMILES | Nc1nc2ncc(C(CO)C(=O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | KCPFENSBZOZTIV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidones |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidamino acid or derivativesamino acidpyrimidonecarboxylic acid derivativepyrimidinebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholpterinazacycleheteroaromatic compoundhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundpyrazinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|