Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 00:24:07 UTC |
---|
Update Date | 2025-03-21 18:38:20 UTC |
---|
HMDB ID | HMDB0141068 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00120240 |
---|
Name | (1E)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)hept-1-ene-3,5-dione |
---|
Frequency | 21.6 |
---|
Structure | |
---|
Chemical Formula | C19H18O5 |
---|
Molecular Mass | 326.1154 |
---|
SMILES | O=C(C=Cc1ccc(O)c(O)c1)CC(=O)CCc1ccc(O)cc1 |
---|
InChI Key | ZGXQKVJJBRIYTA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | diarylheptanoids |
---|
Subclass | linear diarylheptanoids |
---|
Direct Parent | linear diarylheptanoids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsbenzene and substituted derivativesenoneshydrocarbon derivativeshydroxycinnamic acidsketonesorganic oxides |
---|
Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalpha,beta-unsaturated ketonehydroxycinnamic acid or derivativeshydroxycinnamic acidketonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundlinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundenone |
---|