Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:24:08 UTC |
---|
Update Date | 2025-03-21 18:38:21 UTC |
---|
HMDB ID | HMDB0029819 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00120271 |
---|
Name | 2-Phenylethyl beta-D-glucopyranoside |
---|
Frequency | 21.6 |
---|
Structure | |
---|
Chemical Formula | C14H20O6 |
---|
Molecular Mass | 284.126 |
---|
SMILES | OCC1OC(OCCc2ccccc2)C(O)C(O)C1O |
---|
InChI Key | MLRIJUWUQTVDQE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | monosaccharides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
---|
Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharideoxacycleacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compound |
---|