| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:14 UTC |
|---|
| Update Date | 2025-03-21 18:38:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120531 |
|---|
| Frequency | 21.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10Cl2N2O2 |
|---|
| Molecular Mass | 296.0119 |
|---|
| SMILES | NC(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
|---|
| InChI Key | YSEYZNJONYWFQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundsdiarylethersdichlorobenzeneshydrocarbon derivativesn-phenylureasorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupetherorganochlorideorganohalogen compound1,3-dichlorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenecarbonic acid derivativearyl halidearomatic homomonocyclic compoundn-phenylureaorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
