| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:14 UTC |
|---|
| Update Date | 2025-03-21 18:38:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120532 |
|---|
| Frequency | 21.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H32ClN3O2 |
|---|
| Molecular Mass | 477.2183 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CN1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | FBRUTUIPXYBSOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkylhydrazinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdiazinaneshydrocarbon derivativesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidestertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundorganochloridecarboxylic acid derivativeorganohalogen compound1,2-diazinanealkylhydrazineorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compoundaryl chloridechlorobenzenealcoholhydrazine derivativeazacyclecarboxamide groupn-acyl-aminearyl halidetertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
