| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:16 UTC |
|---|
| Update Date | 2025-03-21 18:38:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120587 |
|---|
| Frequency | 21.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O4S |
|---|
| Molecular Mass | 230.0361 |
|---|
| SMILES | CC(=O)Nc1cc(S(N)(=O)=O)ccc1O |
|---|
| InChI Key | QLVZPKCIRTUXKB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesacetanilidesaminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupn-acetylarylamine1-hydroxy-2-unsubstituted benzenoidn-arylamideorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
