Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:24:31 UTC |
---|
Update Date | 2025-03-21 18:38:30 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00121183 |
---|
Frequency | 21.4 |
---|
Structure | |
---|
Chemical Formula | C10H17N4O9P |
---|
Molecular Mass | 368.0733 |
---|
SMILES | NC(=O)c1ncn(C2OC(CO)C(OP(=O)(O)O)C(O)C2O)c1N |
---|
InChI Key | NLSGDVIFINUHMP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | carboxylic acid derivatives |
---|
Direct Parent | 2-heteroaryl carboxamides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarbonylimidazolescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary aminesprimary carboxylic acid amidessecondary alcoholsvinylogous amides |
---|
Substituents | primary carboxylic acid amidecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharide2-heteroaryl carboxamidesaccharideorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundimidazole-4-carbonyl groupoxaneprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
---|