| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:24:31 UTC |
|---|
| Update Date | 2025-03-21 18:38:30 UTC |
|---|
| HMDB ID | HMDB0033244 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00121191 |
|---|
| Name | Dibutyl phthalate |
|---|
| Frequency | 21.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22O4 |
|---|
| Molecular Mass | 278.1518 |
|---|
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC |
|---|
| InChI Key | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acid estersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | benzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
