| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:44 UTC |
|---|
| Update Date | 2025-03-21 18:38:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00121736 |
|---|
| Frequency | 21.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20O4 |
|---|
| Molecular Mass | 300.1362 |
|---|
| SMILES | Oc1cccc(CC2COCC2Cc2ccc(O)c(O)c2)c1 |
|---|
| InChI Key | ZUTFIOWPFBKIEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | tetrahydrofuran lignans |
|---|
| Direct Parent | 9,9'-epoxylignans |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietyetheraromatic heteromonocyclic compoundtetrahydrofuran1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacycleorganic oxygen compoundphenol9,9p-epoxylignanhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
