| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:51 UTC |
|---|
| Update Date | 2025-03-21 18:38:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00121998 |
|---|
| Frequency | 21.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N4O5 |
|---|
| Molecular Mass | 284.1121 |
|---|
| SMILES | Cn1cnc2c(ncn2CC(O)C(O)C(O)CO)c1=O |
|---|
| InChI Key | SSKPWSKPUAWKDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
