| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:51 UTC |
|---|
| Update Date | 2025-03-21 18:38:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122030 |
|---|
| Frequency | 21.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16NO10PS |
|---|
| Molecular Mass | 361.0233 |
|---|
| SMILES | CC1(C)OC2C3OP(=O)(O)OC3COC2(COS(N)(=O)=O)O1 |
|---|
| InChI Key | NREUPCCXGKWQLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dioxolopyrans |
|---|
| Subclass | dioxolopyrans |
|---|
| Direct Parent | dioxolopyrans |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesdioxaphospholaneshydrocarbon derivativesketalsmonosaccharidesorganic nitrogen compoundsorganic oxidesorganic phosphoric acids and derivativesorganic sulfuric acids and derivativesoxacyclic compoundsoxanes |
|---|
| Substituents | meta-dioxolaneorganic sulfuric acid or derivativesmonosaccharide1,3_dioxaphospholanealiphatic heteropolycyclic compoundoxacyclesaccharideorganic oxideorganic oxygen compoundacetalketalhydrocarbon derivativeorganic nitrogen compoundoxanedioxolopyranorganic phosphoric acid derivativeorganooxygen compound |
|---|
