| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:53 UTC |
|---|
| Update Date | 2025-03-21 18:38:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122086 |
|---|
| Frequency | 21.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N2O5 |
|---|
| Molecular Mass | 280.1059 |
|---|
| SMILES | O=C(O)CNC(=O)C(CO)NC(=O)Cc1ccccc1 |
|---|
| InChI Key | KAAWUELXDOVHOL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidscarbonyl compoundscarboxylic acidsdipeptideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidesprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalpha peptideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholphenylacetamidealcoholalpha-amino acid amidecarboxamide groupn-acylglycinearomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundserine or derivativesorganooxygen compound |
|---|
