| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:55 UTC |
|---|
| Update Date | 2025-03-21 18:38:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122157 |
|---|
| Frequency | 21.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H5NO6S |
|---|
| Molecular Mass | 182.9838 |
|---|
| SMILES | NC(C(=O)O)C(=O)S(=O)(=O)O |
|---|
| InChI Key | FNUNWDXUPUBMBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacylsulfonic acidscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic sulfonic acids and derivativesorganonitrogen compoundsorganopnictogen compoundssulfonylsthiolactones |
|---|
| Substituents | acylsulfonic acidaliphatic acyclic compoundcarbonyl groupcarboxylic acidacylsulfonic acid or derivativesorganosulfur compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound1,3-dicarbonyl compoundthiolactoneorganooxygen compound |
|---|
