| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:55 UTC |
|---|
| Update Date | 2025-03-21 18:38:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122162 |
|---|
| Frequency | 21.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9O6P |
|---|
| Molecular Mass | 220.0137 |
|---|
| SMILES | O=P(O)(O)C(O)c1ccc(O)c(O)c1 |
|---|
| InChI Key | FDNDYXWXJNLAPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholsbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
