| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:02 UTC |
|---|
| Update Date | 2025-03-21 18:38:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122452 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O3 |
|---|
| Molecular Mass | 226.063 |
|---|
| SMILES | O=C(O)c1cc2c(cc1O)-c1ccccc1C2 |
|---|
| InChI Key | OXMSZGWMZWYGMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | fluorenes |
|---|
| Subclass | fluorenes |
|---|
| Direct Parent | fluorenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssalicylic acid and derivativesvinylogous acids |
|---|
| Substituents | fluorenecarboxylic acid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundcarboxylic acid derivativehydroxybenzoic acidvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeshydrocarbon derivative1-carboxy-2-haloaromatic compoundorganooxygen compound |
|---|
