| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:03 UTC |
|---|
| Update Date | 2025-03-21 18:38:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122501 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14O5S |
|---|
| Molecular Mass | 270.0562 |
|---|
| SMILES | CS(=O)(=O)Oc1cccc(CC2CCC(=O)O2)c1 |
|---|
| InChI Key | AUVIOXOVXALBND-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmethanesulfonatesmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acid estersoxacyclic compoundssulfonic acid esterssulfonylstetrahydrofurans |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouparomatic heteromonocyclic compoundorganosulfur compoundcarboxylic acid derivativelactonesulfonic acid esterorganic oxideorganoheterocyclic compoundtetrahydrofuranorganosulfonic acid estergamma butyrolactonemethanesulfonateoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativescarboxylic acid esterhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
