| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:04 UTC |
|---|
| Update Date | 2025-03-21 18:38:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122544 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O6 |
|---|
| Molecular Mass | 224.0321 |
|---|
| SMILES | O=C(O)C(=O)Cc1cccc(O)c1C(=O)O |
|---|
| InChI Key | RQAPCHCVSCYFAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha-hydroxy ketonesalpha-keto acids and derivativesbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesphenylpropanoic acidssalicylic acidsvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acid3-phenylpropanoic-acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidalpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidealpha-keto acid1-carboxy-2-haloaromatic compoundbenzoic acidphenylpyruvatebenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsalicylic acid or derivativesketo aciddicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|
