| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:05 UTC |
|---|
| Update Date | 2025-03-21 18:38:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122551 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15NO7S |
|---|
| Molecular Mass | 269.0569 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OS(=O)(=O)O)CC1O |
|---|
| InChI Key | RHYOYAWHNOJPBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxidealkyl sulfateorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteracetamide |
|---|
