| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:06 UTC |
|---|
| Update Date | 2025-03-21 18:38:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122601 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO2 |
|---|
| Molecular Mass | 241.1103 |
|---|
| SMILES | CNC(=O)C(O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | WOSLKBFSUORYCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidessecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl groupcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundsecondary carboxylic acid amidetertiary alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenylacetamideorganooxygen compound |
|---|
