Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:25:07 UTC |
---|
Update Date | 2025-03-21 18:38:48 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00122656 |
---|
Frequency | 21.1 |
---|
Structure | |
---|
Chemical Formula | C3H3NO7S |
---|
Molecular Mass | 196.963 |
---|
SMILES | O=C1NC(=O)C(OS(=O)(=O)O)O1 |
---|
InChI Key | ZSFFQWTZNJTLHC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | azolidines |
---|
Subclass | oxazolidines |
---|
Direct Parent | oxazolidinediones |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | alkyl sulfatesazacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acid derivativeoxazolidinedioneorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidecarbonic acid derivativeorganic sulfuric acid or derivativesazacyclecarbamic acid esteroxacycleorganic oxygen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|