| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:08 UTC |
|---|
| Update Date | 2025-03-21 18:38:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122664 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N7O3S3 |
|---|
| Molecular Mass | 379.0555 |
|---|
| SMILES | CC(=O)NC(CCSCc1csc(N=C(N)N)n1)=NS(N)(=O)=O |
|---|
| InChI Key | DZMGUYRSOWVZKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | thiazoles |
|---|
| Direct Parent | 2,4-disubstituted thiazoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersguanidinesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssulfenyl compounds |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundguanidineorganosulfur compoundcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativessulfenyl compoundazacycledialkylthioetherheteroaromatic compoundorganic 1,3-dipolar compoundorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
