| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:09 UTC |
|---|
| Update Date | 2025-03-21 18:38:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00122701 |
|---|
| Frequency | 21.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6Cl3O2- |
|---|
| Molecular Mass | 238.9439 |
|---|
| SMILES | [O-]OC(c1ccccc1)C(Cl)(Cl)Cl |
|---|
| InChI Key | GPYXNZSNMWUTCS-UHFFFAOYSA-M |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganic anionsorganic peroxidesorganic superoxidesorganochloridesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietyalkyl chlorideorganochlorideorganohalogen compoundaromatic homomonocyclic compoundorganic superoxideorganic oxideorganic anionorganic oxygen compoundalkyl halidehydrocarbon derivativeorganic peroxideorganooxygen compound |
|---|
