| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:18 UTC |
|---|
| Update Date | 2025-03-21 18:38:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123048 |
|---|
| Frequency | 21.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13NO5 |
|---|
| Molecular Mass | 203.0794 |
|---|
| SMILES | CN(CCCC(=O)C(=O)O)CC(=O)O |
|---|
| InChI Key | SGIXFKMXEKSVLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesamino acidscarboxylic acidsdicarboxylic acids and derivativesgamma-amino ketoneshydrocarbon derivativesorganic oxidesorganopnictogen compoundsshort-chain keto acids and derivativestrialkylamines |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidshort-chain keto acidalpha-hydroxy ketoneketoneorganic oxidealpha-amino acidorganonitrogen compoundalpha-keto acidorganopnictogen compoundtertiary aminegamma-aminoketonetertiary aliphatic amineorganic oxygen compoundketo aciddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
