| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:19 UTC |
|---|
| Update Date | 2025-03-21 18:38:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123068 |
|---|
| Frequency | 31.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20N6O4 |
|---|
| Molecular Mass | 312.1546 |
|---|
| SMILES | N=C(NCCCC(N)C(=O)O)NC(Cc1c[nH]cn1)C(=O)O |
|---|
| InChI Key | SVCNEUKIUMYMAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesguanidinesheteroaromatic compoundshydrocarbon derivativesimidazolesiminesmonoalkylaminesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundguanidineimineorganic oxideimidazolearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazoleazacycleheteroaromatic compoundcarboximidamideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
