| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:21 UTC |
|---|
| Update Date | 2025-03-21 18:38:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123161 |
|---|
| Frequency | 21.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H26O5 |
|---|
| Molecular Mass | 286.178 |
|---|
| SMILES | CCC(C)(C)C(=O)OC1OC(C(=O)O)C(C)C(C)C1C |
|---|
| InChI Key | JLDYJJNBKNGSBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanes |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativescarboxylic acid derivativeoxacyclefatty acid esterorganic oxideorganic oxygen compoundacetalcarboxylic acid esteraliphatic heteromonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeoxaneorganooxygen compound |
|---|
