| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:22 UTC |
|---|
| Update Date | 2025-03-21 18:38:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123199 |
|---|
| Frequency | 20.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O |
|---|
| Molecular Mass | 256.1576 |
|---|
| SMILES | CCN(CC)CC(=O)Nc1cccc2ccccc12 |
|---|
| InChI Key | DHPIEQRATJYNJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesnaphthalenesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupalpha-amino acid amidetertiary aliphatic aminen-arylamidearomatic homopolycyclic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxidenaphthaleneorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
