| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:24 UTC |
|---|
| Update Date | 2025-03-21 18:38:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123278 |
|---|
| Frequency | 20.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO5 |
|---|
| Molecular Mass | 223.0481 |
|---|
| SMILES | COc1ccc(NC=O)c(C(=O)C(=O)O)c1 |
|---|
| InChI Key | OMSZORVWVGXKRL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha-keto acids and derivativesanisolesaryl ketonesbenzoyl derivativescarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidbenzoyln-arylamidealkyl aryl ethercarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundvinylogous amidecarboxamide groupmethoxybenzenearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundanisoleketo acidhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundaryl ketone |
|---|
