Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:25:36 UTC |
---|
Update Date | 2025-03-21 18:39:02 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00123705 |
---|
Frequency | 20.8 |
---|
Structure | |
---|
Chemical Formula | C10H13NO4S |
---|
Molecular Mass | 243.0565 |
---|
SMILES | CC(=O)NCCSCc1ccc(C(=O)O)o1 |
---|
InChI Key | DRJRVBUVPFVZHX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | furans |
---|
Subclass | furoic acid and derivatives |
---|
Direct Parent | furoic acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetamidescarbonyl compoundscarboxylic acidsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidessulfenyl compounds |
---|
Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundorganosulfur compoundcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidesulfenyl compounddialkylthioetherheteroaromatic compoundcarboxamide groupfuroic acidoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|