| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:42 UTC |
|---|
| Update Date | 2025-03-21 18:39:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00123945 |
|---|
| Frequency | 49.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N4O3 |
|---|
| Molecular Mass | 234.0753 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1C=CC(O)C1O |
|---|
| InChI Key | ULIPZFPGLCSSLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazole1,2-dioln-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
