| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:44 UTC |
|---|
| Update Date | 2025-03-21 18:39:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124010 |
|---|
| Frequency | 20.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H27NO3 |
|---|
| Molecular Mass | 341.1991 |
|---|
| SMILES | CN(C)CCOC(c1ccccc1)c1ccc(C(C)(C)C(=O)O)cc1 |
|---|
| InChI Key | PENMZEWRWHCBJF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsbenzyletherscarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylpropanestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupethercarboxylic acidbenzyletheramino acid or derivativesamino acidcarboxylic acid derivativedialkyl etherphenylpropaneorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminetertiary aliphatic aminearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
