| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:56 UTC |
|---|
| Update Date | 2025-03-21 18:39:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124469 |
|---|
| Frequency | 20.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H25N3O7 |
|---|
| Molecular Mass | 407.1692 |
|---|
| SMILES | CCOC(=O)N1CCN(c2ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc2)CC1 |
|---|
| InChI Key | GZVSBBGBJPGVJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzoyl derivativescarbamate esterscarbonyl compoundscarboxylic acidsdialkylarylaminesdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsn-arylpiperazinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsphenylpiperazinespiperazine carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | piperazine-1-carboxylic acidmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoylbenzamideorganic oxidepiperazinetertiary aliphatic/aromatic amineorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary amineorganoheterocyclic compoundn-acyl-alpha amino acid or derivativescarbonic acid derivativeazacyclen-acyl-alpha-amino acidhippuric acid or derivativesaniline or substituted anilinescarbamic acid esterbenzoic acid or derivativesglutamic acid or derivativescarboxamide groupaminobenzamidephenylpiperazinesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
