| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:56 UTC |
|---|
| Update Date | 2025-03-21 18:39:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124488 |
|---|
| Frequency | 20.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H34N2O3 |
|---|
| Molecular Mass | 458.2569 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(O)cc2)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | LTMDSEWWMRPJPZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidesphenylpiperidinestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminetertiary alcoholorganic oxygen compoundphenylpiperidinephenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
