| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:56 UTC |
|---|
| Update Date | 2025-03-21 18:39:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124496 |
|---|
| Frequency | 20.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO2 |
|---|
| Molecular Mass | 193.1103 |
|---|
| SMILES | [O-][n+]1cccc(C2(O)CCCCC2)c1 |
|---|
| InChI Key | PAVWHWMETJHEMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundhydroxypyridinecyclohexanolcyclic alcoholtertiary alcoholorganic oxidepyridineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compound |
|---|