| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:25:57 UTC |
|---|
| Update Date | 2025-03-21 18:39:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124516 |
|---|
| Frequency | 20.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O7P |
|---|
| Molecular Mass | 226.0242 |
|---|
| SMILES | O=C1CCC(O)C(COP(=O)(O)O)O1 |
|---|
| InChI Key | GTRJLKVPKIJZDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupdelta valerolactonecarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhexose phosphatehydrocarbon derivativeoxanedelta_valerolactoneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|
