| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:00 UTC |
|---|
| Update Date | 2025-03-21 18:39:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124620 |
|---|
| Frequency | 20.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14N2O2 |
|---|
| Molecular Mass | 242.1055 |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccc(N)cc2)cc1 |
|---|
| InChI Key | VOACWDOXELDOSJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsprimary aminessecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethern-acetylarylamineamino acid or derivativesn-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundphenoxy compounddiphenyletheramineorganooxygen compound |
|---|
