| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:06 UTC |
|---|
| Update Date | 2025-03-21 18:39:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124897 |
|---|
| Frequency | 20.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O2 |
|---|
| Molecular Mass | 258.1368 |
|---|
| SMILES | NCC(N)Cc1ccc(Oc2ccc(O)cc2)cc1 |
|---|
| InChI Key | WUCBSJIUWKITIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamphetamines and derivativesdiarylethershydrocarbon derivativesmonoalkylaminesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherether1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundphenoxy compounddiphenyletherorganooxygen compoundamphetamine or derivatives |
|---|
