| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:26:07 UTC |
|---|
| Update Date | 2025-03-21 18:39:18 UTC |
|---|
| HMDB ID | HMDB0014847 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124933 |
|---|
| Name | Lamivudine |
|---|
| Frequency | 20.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N3O3S |
|---|
| Molecular Mass | 229.0521 |
|---|
| SMILES | Nc1ccn(C2CSC(CO)O2)c(=O)n1 |
|---|
| InChI Key | JTEGQNOMFQHVDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | 3'-thia pyrimidine nucleosides |
|---|
| Direct Parent | 3'-thia pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonothioacetalsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxathiolanesprimary alcoholsprimary aminespyrimidones |
|---|
| Substituents | oxathiolanearomatic heteromonocyclic compoundpyrimidonepyrimidinemonothioacetalorganic oxideorganonitrogen compoundorganopnictogen compound3'-thia pyrimidine nucleosideprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
