| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:26:08 UTC |
|---|
| Update Date | 2025-03-21 18:39:18 UTC |
|---|
| HMDB ID | HMDB0135756 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00124975 |
|---|
| Name | 2,4-dihydroxy-3,5-dimethoxybenzoic acid |
|---|
| Frequency | 20.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O6 |
|---|
| Molecular Mass | 214.0477 |
|---|
| SMILES | COc1cc(C(=O)O)c(O)c(OC)c1O |
|---|
| InChI Key | KXYFGQOTAHBUKU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds4-alkoxyphenolsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativesdimethoxybenzeneshydrocarbon derivativesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsresorcinolssalicylic acidsvinylogous acids |
|---|
| Substituents | phenol etherethercarboxylic acidbenzoylmethoxyphenolsalicylic acidalkyl aryl ethercarboxylic acid derivativeresorcinoldimethoxybenzeneorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidm-methoxybenzoic acid or derivatives4-alkoxyphenolmethoxybenzenehydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesm-dimethoxybenzeneanisolephenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
