Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:26:10 UTC |
---|
Update Date | 2025-03-21 18:39:19 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00125055 |
---|
Frequency | 20.5 |
---|
Structure | |
---|
Chemical Formula | C16H22N2O8 |
---|
Molecular Mass | 370.1376 |
---|
SMILES | CN(C)CC(=O)Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
---|
InChI Key | FOGYUPLZGCGAPU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsalpha amino acid amidesalpha amino acidsamino acidsanilidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acido-glucuronidemonosacchariden-arylamidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxanetertiary amineorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesalpha-amino acid amidetertiary aliphatic aminehydroxy acidcarboxamide groupanilideoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamine |
---|