Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:26:10 UTC |
---|
Update Date | 2025-03-21 18:39:19 UTC |
---|
HMDB ID | HMDB0240548 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00125056 |
---|
Name | O-Coumaric acid glucuronide |
---|
Frequency | 20.5 |
---|
Structure | |
---|
Chemical Formula | C15H16O9 |
---|
Molecular Mass | 340.0794 |
---|
SMILES | O=C(O)C=Cc1ccccc1OC1OC(C(=O)O)C(O)C(O)C1O |
---|
InChI Key | KRKMNGLGYXJMBZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscinnamic acids and derivativesdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidecinnamic acid or derivativesbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compound |
---|