Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:26:14 UTC |
---|
Update Date | 2025-03-21 18:39:20 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00125195 |
---|
Frequency | 20.5 |
---|
Structure | |
---|
Chemical Formula | C9H7NO5S |
---|
Molecular Mass | 241.0045 |
---|
SMILES | O=C(O)c1c[nH]c2ccc(S(=O)(=O)O)cc12 |
---|
InChI Key | ZGUVSFWFQPTKGB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | indoles and derivatives |
---|
Subclass | indolecarboxylic acids and derivatives |
---|
Direct Parent | indolecarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonic acidspyrrole carboxylic acidssulfonylsvinylogous amides |
---|
Substituents | organosulfonic acid or derivativescarboxylic acidpyrrole-3-carboxylic acid or derivativesindoleorganosulfonic acidorganosulfur compoundcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundindolecarboxylic acid derivativevinylogous amide1-sulfo,2-unsubstituted aromatic compoundazacycleheteroaromatic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativespyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundpyrrole-3-carboxylic acidorganooxygen compound |
---|