| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:18 UTC |
|---|
| Update Date | 2025-03-21 18:39:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00125362 |
|---|
| Frequency | 20.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H29N5O7P+ |
|---|
| Molecular Mass | 482.1799 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)COP(=O)(O)OCC[N+](C)(C)C)c2cc1C |
|---|
| InChI Key | UDFNJMABUPCFFK-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aminesazacyclic compoundsbenzenoidsdialkyl phosphatesdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphocholinespyrazinespyrimidonesquinoxalinessecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | lactampyrimidoneflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltalcoholquinoxalinecarbonic acid derivativetetraalkylammonium saltazacyclequaternary ammonium saltheteroaromatic compoundphosphocholinedialkyl phosphateorganic oxygen compoundphosphoric acid esterpyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
