| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:26:20 UTC |
|---|
| Update Date | 2025-03-21 18:39:23 UTC |
|---|
| HMDB ID | HMDB0035208 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00125431 |
|---|
| Name | Aflatoxin B2 |
|---|
| Frequency | 20.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O6 |
|---|
| Molecular Mass | 314.079 |
|---|
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)CCC4=O)C1CCOC1O2 |
|---|
| InChI Key | WWSYXEZEXMQWHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | furanocoumarins |
|---|
| Direct Parent | difurocoumarocyclopentenones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsalkyl aryl ethersangular furanocoumarinsanisolesaryl alkyl ketonescoumaransdifurocoumarinsheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivativestetrahydrofurans |
|---|
| Substituents | difurocoumarocyclopentenonephenol etheretheraryl alkyl ketone1-benzopyranalkyl aryl etherketonelactoneorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundcoumarandifurocoumarinbenzopyrantetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
