| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:20 UTC |
|---|
| Update Date | 2025-03-21 18:39:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00125457 |
|---|
| Frequency | 20.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14Cl2N6O2 |
|---|
| Molecular Mass | 368.0555 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(CNc1ccc(Cl)c(Cl)c1)N2C=O |
|---|
| InChI Key | KQOXTNWRZWMNFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganochloridesorganopnictogen compoundsphenylalkylaminesprimary aminespyrimidonessecondary alkylarylaminestertiary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativesorganochloridepyrimidonecarboxylic acid derivativeorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzenearyl chloridechlorobenzenevinylogous amidepterinazacycleheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic aminearyl halideorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
