| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:25 UTC |
|---|
| Update Date | 2025-03-21 18:39:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00125628 |
|---|
| Frequency | 20.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6O8S |
|---|
| Molecular Mass | 213.9783 |
|---|
| SMILES | O=CC(O)C(O)C(=O)OS(=O)(=O)O |
|---|
| InChI Key | FTDPOXUEXWPRKX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-hydroxyaldehydesbeta-hydroxy aldehydeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundbeta-hydroxy aldehydesulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesmonosaccharidealdehydecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesalpha-hydroxyaldehydeorganic oxygen compoundsecondary alcoholhydrocarbon derivativesulfuric acid esterorganooxygen compound1,2-diol |
|---|
