| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:32 UTC |
|---|
| Update Date | 2025-03-21 18:39:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00125917 |
|---|
| Frequency | 20.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O6 |
|---|
| Molecular Mass | 260.1008 |
|---|
| SMILES | O=C1CCN(C2OC(CO)C(O)C2O)CC(=O)N1 |
|---|
| InChI Key | QWSQXGYHOIQOBF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,4-diazepanesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshemiaminalshydrocarbon derivativesmonosaccharidesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl group1,4-diazepanemonosaccharidediazepanehemiaminalcarboxylic acid imide, n-unsubstitutedsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideprimary alcoholorganoheterocyclic compoundalcoholazacycletetrahydrofurancarboxylic acid imideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
