| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:40 UTC |
|---|
| Update Date | 2025-03-21 18:39:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126252 |
|---|
| Frequency | 20.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O |
|---|
| Molecular Mass | 256.1576 |
|---|
| SMILES | CN(C)CCC(c1ccccn1)c1ccccc1O |
|---|
| InChI Key | IJPJZCLXGDAJIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pheniramines |
|---|
| Direct Parent | pheniramines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganooxygen compoundsorganopnictogen compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundpheniramineazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridine1-hydroxy-2-unsubstituted benzenoidmethylpyridine1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
