| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:41 UTC |
|---|
| Update Date | 2025-03-21 18:39:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126290 |
|---|
| Frequency | 20.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O8P |
|---|
| Molecular Mass | 228.0035 |
|---|
| SMILES | O=P1(O)OC2OC(O1)C(O)C(O)C2O |
|---|
| InChI Key | GDGWVLMODOWDMM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonosaccharidealiphatic heteropolycyclic compoundoxacycleorganic oxidesecondary alcoholhydrocarbon derivativeoxaneorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|
