| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:26:41 UTC |
|---|
| Update Date | 2025-03-21 18:39:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00126298 |
|---|
| Frequency | 20.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N3O8P |
|---|
| Molecular Mass | 335.0519 |
|---|
| SMILES | Nc1ccn(C2OC3COP(=O)(O)OC3C(O)C2O)c(=O)n1 |
|---|
| InChI Key | UBLFWPHBWVSKBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneimidolactamorganoheterocyclic compound1,2-diolalcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacyclesecondary alcoholhexose phosphatehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamine |
|---|
